C25H22N4O4S — CID 21224945
3-[[1-(4-aminobenzoyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-5-phenyl-1H-imidazol-2-one (PubChem CID 21224945) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 3-[[1-(4-aminobenzoyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-5-phenyl-1H-imidazol-2-one.
| Compound Name | 3-[[1-(4-aminobenzoyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-5-phenyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 21224945 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[[1-(4-aminobenzoyl)-2-methyl-2,3-dihydroindol-5-yl]sulfonyl]-5-phenyl-1H-imidazol-2-one |
| SMILES | CC1Cc2cc(S(=O)(=O)n3cc(-c4ccccc4)[nH]c3=O)ccc2N1C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H22N4O4S/c1-16-13-19-14-21(11-12-23(19)29(16)24(30)18-7-9-20(26)10-8-18)34(32,33)28-15-22(27-25(28)31)17-5-3-2-4-6-17/h2-12,14-16H,13,26H2,1H3,(H,27,31) |
| InChIKey | MKSNIAYDFRVIPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|