About 1-hydroxypyrrol-2-ol
1-hydroxypyrrol-2-ol (PubChem CID 21225236) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 1-hydroxypyrrol-2-ol.
Molecular Properties
| Compound Name | 1-hydroxypyrrol-2-ol |
| PubChem CID | 21225236 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 1-hydroxypyrrol-2-ol |
| SMILES | Oc1cccn1O |
| InChI | InChI=1S/C4H5NO2/c6-4-2-1-3-5(4)7/h1-3,6-7H |
| InChIKey | GUMHIQSZHCYMSN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyrrol-2-ol?
The IUPAC name of 1-hydroxypyrrol-2-ol (CID 21225236) is 1-hydroxypyrrol-2-ol.
What is the SMILES notation for 1-hydroxypyrrol-2-ol?
The canonical SMILES for 1-hydroxypyrrol-2-ol is Oc1cccn1O.
What is the InChIKey of 1-hydroxypyrrol-2-ol?
The InChIKey is GUMHIQSZHCYMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c6-4-2-1-3-5(4)7/h1-3,6-7H.
What are the key properties of 1-hydroxypyrrol-2-ol?
1-hydroxypyrrol-2-ol has a molecular weight of 99.09 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyrrol-2-ol is sourced from PubChem (CID 21225236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).