C7H8ClF7O — CID 21225311
4-(3-chloropropoxy)-1,1,1,2,2,3,3-heptafluorobutane (PubChem CID 21225311) has the molecular formula C7H8ClF7O and a molecular weight of 276.58 g/mol. Its IUPAC name is 4-(3-chloropropoxy)-1,1,1,2,2,3,3-heptafluorobutane.
| Compound Name | 4-(3-chloropropoxy)-1,1,1,2,2,3,3-heptafluorobutane |
|---|---|
| PubChem CID | 21225311 |
| Molecular Formula | C7H8ClF7O |
| Molecular Weight | 276.58 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 4-(3-chloropropoxy)-1,1,1,2,2,3,3-heptafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COCCCCl |
| InChI | InChI=1S/C7H8ClF7O/c8-2-1-3-16-4-5(9,10)6(11,12)7(13,14)15/h1-4H2 |
| InChIKey | ZCNLFVWHRBVTLL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|