C11H8BrF15O2 — CID 21225322
1-[4-(3-bromopropoxy)-1,1,2,2,3,3-hexafluorobutoxy]-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 21225322) has the molecular formula C11H8BrF15O2 and a molecular weight of 537.06 g/mol. Its IUPAC name is 1-[4-(3-bromopropoxy)-1,1,2,2,3,3-hexafluorobutoxy]-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-[4-(3-bromopropoxy)-1,1,2,2,3,3-hexafluorobutoxy]-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 21225322 |
| Molecular Formula | C11H8BrF15O2 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | 1-[4-(3-bromopropoxy)-1,1,2,2,3,3-hexafluorobutoxy]-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)COCCCBr |
| InChI | InChI=1S/C11H8BrF15O2/c12-2-1-3-28-4-5(13,14)6(15,16)10(24,25)29-11(26,27)8(19,20)7(17,18)9(21,22)23/h1-4H2 |
| InChIKey | WBSBDLWWYQHYTG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|