C9H6BrF13O4 — CID 21225352
1-[2-(2-bromoethoxy)-1,1-difluoroethoxy]-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane (PubChem CID 21225352) has the molecular formula C9H6BrF13O4 and a molecular weight of 505.02 g/mol. Its IUPAC name is 1-[2-(2-bromoethoxy)-1,1-difluoroethoxy]-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane.
| Compound Name | 1-[2-(2-bromoethoxy)-1,1-difluoroethoxy]-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane |
|---|---|
| PubChem CID | 21225352 |
| Molecular Formula | C9H6BrF13O4 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 503.92 |
| IUPAC Name | 1-[2-(2-bromoethoxy)-1,1-difluoroethoxy]-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane |
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCCBr |
| InChI | InChI=1S/C9H6BrF13O4/c10-1-2-24-3-4(11,12)25-5(13,14)6(15,16)26-7(17,18)8(19,20)27-9(21,22)23/h1-3H2 |
| InChIKey | COIISZWJSLVVAM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|