C10H10ClF11O3 — CID 21225365
1-chloro-4-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]butane (PubChem CID 21225365) has the molecular formula C10H10ClF11O3 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-chloro-4-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]butane.
| Compound Name | 1-chloro-4-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]butane |
|---|---|
| PubChem CID | 21225365 |
| Molecular Formula | C10H10ClF11O3 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 1-chloro-4-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]butane |
| SMILES | FC(F)(COCCCCCl)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF11O3/c11-3-1-2-4-23-5-6(12,13)24-9(19,20)10(21,22)25-8(17,18)7(14,15)16/h1-5H2 |
| InChIKey | JWRHFVZZHYHIFX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|