About 4,5-dioxohept-6-enyl 3-oxobutanoate
4,5-dioxohept-6-enyl 3-oxobutanoate (PubChem CID 21225467) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is 4,5-dioxohept-6-enyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 4,5-dioxohept-6-enyl 3-oxobutanoate |
| PubChem CID | 21225467 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4,5-dioxohept-6-enyl 3-oxobutanoate |
| SMILES | C=CC(=O)C(=O)CCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C11H14O5/c1-3-9(13)10(14)5-4-6-16-11(15)7-8(2)12/h3H,1,4-7H2,2H3 |
| InChIKey | NQIOQHQUSMRIMF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dioxohept-6-enyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dioxohept-6-enyl 3-oxobutanoate?
The IUPAC name of 4,5-dioxohept-6-enyl 3-oxobutanoate (CID 21225467) is 4,5-dioxohept-6-enyl 3-oxobutanoate.
What is the SMILES notation for 4,5-dioxohept-6-enyl 3-oxobutanoate?
The canonical SMILES for 4,5-dioxohept-6-enyl 3-oxobutanoate is C=CC(=O)C(=O)CCCOC(=O)CC(C)=O.
What is the InChIKey of 4,5-dioxohept-6-enyl 3-oxobutanoate?
The InChIKey is NQIOQHQUSMRIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-3-9(13)10(14)5-4-6-16-11(15)7-8(2)12/h3H,1,4-7H2,2H3.
What are the key properties of 4,5-dioxohept-6-enyl 3-oxobutanoate?
4,5-dioxohept-6-enyl 3-oxobutanoate has a molecular weight of 226.23 g/mol, XLogP of 0.61, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dioxohept-6-enyl 3-oxobutanoate is sourced from PubChem (CID 21225467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).