About (Z)-2,3-dibutylbut-2-enedioate
(Z)-2,3-dibutylbut-2-enedioate (PubChem CID 21225748) has the molecular formula C12H18O4-2
and a molecular weight of 226.27 g/mol. Its IUPAC name is (Z)-2,3-dibutylbut-2-enedioate.
Molecular Properties
| Compound Name | (Z)-2,3-dibutylbut-2-enedioate |
| PubChem CID | 21225748 |
| Molecular Formula | C12H18O4-2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (Z)-2,3-dibutylbut-2-enedioate |
| SMILES | CCCC/C(C(=O)[O-])=C(\CCCC)C(=O)[O-] |
| InChI | InChI=1S/C12H20O4/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2/h3-8H2,1-2H3,(H,13,14)(H,15,16)/p-2/b10-9- |
| InChIKey | DRTFPRNYUARGTQ-KTKRTIGZSA-L |
| XLogP | 0.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dibutylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dibutylbut-2-enedioate?
The IUPAC name of (Z)-2,3-dibutylbut-2-enedioate (CID 21225748) is (Z)-2,3-dibutylbut-2-enedioate.
What is the SMILES notation for (Z)-2,3-dibutylbut-2-enedioate?
The canonical SMILES for (Z)-2,3-dibutylbut-2-enedioate is CCCC/C(C(=O)[O-])=C(\CCCC)C(=O)[O-].
What is the InChIKey of (Z)-2,3-dibutylbut-2-enedioate?
The InChIKey is DRTFPRNYUARGTQ-KTKRTIGZSA-L. The full InChI is InChI=1S/C12H20O4/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2/h3-8H2,1-2H3,(H,13,14)(H,15,16)/p-2/b10-9-.
What are the key properties of (Z)-2,3-dibutylbut-2-enedioate?
(Z)-2,3-dibutylbut-2-enedioate has a molecular weight of 226.27 g/mol, XLogP of 0.16, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dibutylbut-2-enedioate is sourced from PubChem (CID 21225748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).