About (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate
(2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate (PubChem CID 21225802) has the molecular formula C14H6Cl4O4
and a molecular weight of 380.01 g/mol. Its IUPAC name is (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate.
Molecular Properties
| Compound Name | (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate |
| PubChem CID | 21225802 |
| Molecular Formula | C14H6Cl4O4 |
| Molecular Weight | 380.01 g/mol |
| Exact Mass | 377.90 |
| IUPAC Name | (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H6Cl4O4/c15-9-5-1-3-7(11(9)17)13(19)21-22-14(20)8-4-2-6-10(16)12(8)18/h1-6H |
| InChIKey | BOOBDAVNHSOIDB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate?
The IUPAC name of (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate (CID 21225802) is (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate.
What is the SMILES notation for (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate?
The canonical SMILES for (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate is O=C(OOC(=O)c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl.
What is the InChIKey of (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate?
The InChIKey is BOOBDAVNHSOIDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl4O4/c15-9-5-1-3-7(11(9)17)13(19)21-22-14(20)8-4-2-6-10(16)12(8)18/h1-6H.
What are the key properties of (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate?
(2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate has a molecular weight of 380.01 g/mol, XLogP of 5.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorobenzoyl) 2,3-dichlorobenzenecarboperoxoate is sourced from PubChem (CID 21225802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).