About (2,5-dioxopyrrol-1-yl) propane-2-sulfonate
(2,5-dioxopyrrol-1-yl) propane-2-sulfonate (PubChem CID 21225839) has the molecular formula C7H9NO5S
and a molecular weight of 219.22 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) propane-2-sulfonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrol-1-yl) propane-2-sulfonate |
| PubChem CID | 21225839 |
| Molecular Formula | C7H9NO5S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) propane-2-sulfonate |
| SMILES | CC(C)S(=O)(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H9NO5S/c1-5(2)14(11,12)13-8-6(9)3-4-7(8)10/h3-5H,1-2H3 |
| InChIKey | VOOHNYSRQMOVPZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrol-1-yl) propane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrol-1-yl) propane-2-sulfonate?
The IUPAC name of (2,5-dioxopyrrol-1-yl) propane-2-sulfonate (CID 21225839) is (2,5-dioxopyrrol-1-yl) propane-2-sulfonate.
What is the SMILES notation for (2,5-dioxopyrrol-1-yl) propane-2-sulfonate?
The canonical SMILES for (2,5-dioxopyrrol-1-yl) propane-2-sulfonate is CC(C)S(=O)(=O)ON1C(=O)C=CC1=O.
What is the InChIKey of (2,5-dioxopyrrol-1-yl) propane-2-sulfonate?
The InChIKey is VOOHNYSRQMOVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO5S/c1-5(2)14(11,12)13-8-6(9)3-4-7(8)10/h3-5H,1-2H3.
What are the key properties of (2,5-dioxopyrrol-1-yl) propane-2-sulfonate?
(2,5-dioxopyrrol-1-yl) propane-2-sulfonate has a molecular weight of 219.22 g/mol, XLogP of -0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrol-1-yl) propane-2-sulfonate is sourced from PubChem (CID 21225839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).