About 1,10-phenanthroline;hydrate
1,10-phenanthroline;hydrate (PubChem CID 21226) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,10-phenanthroline;hydrate.
Molecular Properties
| Compound Name | 1,10-phenanthroline;hydrate |
| PubChem CID | 21226 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1,10-phenanthroline;hydrate |
| SMILES | O.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H2 |
| InChIKey | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,10-phenanthroline;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-phenanthroline;hydrate?
The IUPAC name of 1,10-phenanthroline;hydrate (CID 21226) is 1,10-phenanthroline;hydrate.
What is the SMILES notation for 1,10-phenanthroline;hydrate?
The canonical SMILES for 1,10-phenanthroline;hydrate is O.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of 1,10-phenanthroline;hydrate?
The InChIKey is PPQJCISYYXZCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H2.
What are the key properties of 1,10-phenanthroline;hydrate?
1,10-phenanthroline;hydrate has a molecular weight of 198.22 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-phenanthroline;hydrate is sourced from PubChem (CID 21226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).