C16H12Cl2N4S2 — CID 21226050
1,5-bis(2-chlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 21226050) has the molecular formula C16H12Cl2N4S2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 1,5-bis(2-chlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | 1,5-bis(2-chlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 21226050 |
| Molecular Formula | C16H12Cl2N4S2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1,5-bis(2-chlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1NC(c2ccccc2Cl)N2C(=S)NC(c3ccccc3Cl)N12 |
| InChI | InChI=1S/C16H12Cl2N4S2/c17-11-7-3-1-5-9(11)13-19-15(23)22-14(20-16(24)21(13)22)10-6-2-4-8-12(10)18/h1-8,13-14H,(H,19,23)(H,20,24) |
| InChIKey | PJDDFKGDNUTITH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|