hydroxymethanesulfinyl chloride

CH3ClO2S — CID 21226261

IUPAChydroxymethanesulfinyl chloride
SMILESO=S(Cl)CO
InChIInChI=1S/CH3ClO2S/c2-5(4)1-3/h3H,1H2
InChIKeyZRIOVPNRLYHBKC-UHFFFAOYSA-N
MW114.55 g/mol
LogP-0.16
Rot. Bonds1

About hydroxymethanesulfinyl chloride

hydroxymethanesulfinyl chloride (PubChem CID 21226261) has the molecular formula CH3ClO2S and a molecular weight of 114.55 g/mol. Its IUPAC name is hydroxymethanesulfinyl chloride.

Molecular Properties

Compound Namehydroxymethanesulfinyl chloride
PubChem CID21226261
Molecular FormulaCH3ClO2S
Molecular Weight114.55 g/mol
Exact Mass113.95
IUPAC Namehydroxymethanesulfinyl chloride
SMILESO=S(Cl)CO
InChIInChI=1S/CH3ClO2S/c2-5(4)1-3/h3H,1H2
InChIKeyZRIOVPNRLYHBKC-UHFFFAOYSA-N
XLogP-0.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.55
LogP ≤ 5-0.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze hydroxymethanesulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydroxymethanesulfinyl chloride?
The IUPAC name of hydroxymethanesulfinyl chloride (CID 21226261) is hydroxymethanesulfinyl chloride.
What is the SMILES notation for hydroxymethanesulfinyl chloride?
The canonical SMILES for hydroxymethanesulfinyl chloride is O=S(Cl)CO.
What is the InChIKey of hydroxymethanesulfinyl chloride?
The InChIKey is ZRIOVPNRLYHBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3ClO2S/c2-5(4)1-3/h3H,1H2.
What are the key properties of hydroxymethanesulfinyl chloride?
hydroxymethanesulfinyl chloride has a molecular weight of 114.55 g/mol, XLogP of -0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethanesulfinyl chloride is sourced from PubChem (CID 21226261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).