About 2,3,4,5-tetraoxohexanedial
2,3,4,5-tetraoxohexanedial (PubChem CID 21226296) has the molecular formula C6H2O6
and a molecular weight of 170.08 g/mol. Its IUPAC name is 2,3,4,5-tetraoxohexanedial.
Molecular Properties
| Compound Name | 2,3,4,5-tetraoxohexanedial |
| PubChem CID | 21226296 |
| Molecular Formula | C6H2O6 |
| Molecular Weight | 170.08 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 2,3,4,5-tetraoxohexanedial |
| SMILES | O=CC(=O)C(=O)C(=O)C(=O)C=O |
| InChI | InChI=1S/C6H2O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1-2H |
| InChIKey | YCZAUWRMGIHKEC-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.08 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetraoxohexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetraoxohexanedial?
The IUPAC name of 2,3,4,5-tetraoxohexanedial (CID 21226296) is 2,3,4,5-tetraoxohexanedial.
What is the SMILES notation for 2,3,4,5-tetraoxohexanedial?
The canonical SMILES for 2,3,4,5-tetraoxohexanedial is O=CC(=O)C(=O)C(=O)C(=O)C=O.
What is the InChIKey of 2,3,4,5-tetraoxohexanedial?
The InChIKey is YCZAUWRMGIHKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1-2H.
What are the key properties of 2,3,4,5-tetraoxohexanedial?
2,3,4,5-tetraoxohexanedial has a molecular weight of 170.08 g/mol, XLogP of -2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetraoxohexanedial is sourced from PubChem (CID 21226296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).