About 3-nonanoylazepan-2-one
3-nonanoylazepan-2-one (PubChem CID 21226503) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-nonanoylazepan-2-one.
Molecular Properties
| Compound Name | 3-nonanoylazepan-2-one |
| PubChem CID | 21226503 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-nonanoylazepan-2-one |
| SMILES | CCCCCCCCC(=O)C1CCCCNC1=O |
| InChI | InChI=1S/C15H27NO2/c1-2-3-4-5-6-7-11-14(17)13-10-8-9-12-16-15(13)18/h13H,2-12H2,1H3,(H,16,18) |
| InChIKey | CLSGAPMZXLVENM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-nonanoylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonanoylazepan-2-one?
The IUPAC name of 3-nonanoylazepan-2-one (CID 21226503) is 3-nonanoylazepan-2-one.
What is the SMILES notation for 3-nonanoylazepan-2-one?
The canonical SMILES for 3-nonanoylazepan-2-one is CCCCCCCCC(=O)C1CCCCNC1=O.
What is the InChIKey of 3-nonanoylazepan-2-one?
The InChIKey is CLSGAPMZXLVENM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-2-3-4-5-6-7-11-14(17)13-10-8-9-12-16-15(13)18/h13H,2-12H2,1H3,(H,16,18).
What are the key properties of 3-nonanoylazepan-2-one?
3-nonanoylazepan-2-one has a molecular weight of 253.39 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonanoylazepan-2-one is sourced from PubChem (CID 21226503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).