About 3,4-diaminobutan-2-one
3,4-diaminobutan-2-one (PubChem CID 21226596) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is 3,4-diaminobutan-2-one.
Molecular Properties
| Compound Name | 3,4-diaminobutan-2-one |
| PubChem CID | 21226596 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 3,4-diaminobutan-2-one |
| SMILES | CC(=O)C(N)CN |
| InChI | InChI=1S/C4H10N2O/c1-3(7)4(6)2-5/h4H,2,5-6H2,1H3 |
| InChIKey | HPYKHRGGYKDQIV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-diaminobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminobutan-2-one?
The IUPAC name of 3,4-diaminobutan-2-one (CID 21226596) is 3,4-diaminobutan-2-one.
What is the SMILES notation for 3,4-diaminobutan-2-one?
The canonical SMILES for 3,4-diaminobutan-2-one is CC(=O)C(N)CN.
What is the InChIKey of 3,4-diaminobutan-2-one?
The InChIKey is HPYKHRGGYKDQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3(7)4(6)2-5/h4H,2,5-6H2,1H3.
What are the key properties of 3,4-diaminobutan-2-one?
3,4-diaminobutan-2-one has a molecular weight of 102.14 g/mol, XLogP of -1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminobutan-2-one is sourced from PubChem (CID 21226596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).