C18H16N6O3S — CID 21226865
8-methyl-12-(2-phenoxyethylsulfonyl)-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene (PubChem CID 21226865) has the molecular formula C18H16N6O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is 8-methyl-12-(2-phenoxyethylsulfonyl)-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene.
| Compound Name | 8-methyl-12-(2-phenoxyethylsulfonyl)-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene |
|---|---|
| PubChem CID | 21226865 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 8-methyl-12-(2-phenoxyethylsulfonyl)-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaene |
| SMILES | Cn1c2ccccc2n2c1nn1c(S(=O)(=O)CCOc3ccccc3)nnc12 |
| InChI | InChI=1S/C18H16N6O3S/c1-22-14-9-5-6-10-15(14)23-16-19-20-18(24(16)21-17(22)23)28(25,26)12-11-27-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3 |
| InChIKey | WRHKEMFEEIENPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |