C15H10N6S — CID 21226906
8-phenyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,14-pentaene-12-thione (PubChem CID 21226906) has the molecular formula C15H10N6S and a molecular weight of 306.35 g/mol. Its IUPAC name is 8-phenyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,14-pentaene-12-thione.
| Compound Name | 8-phenyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,14-pentaene-12-thione |
|---|---|
| PubChem CID | 21226906 |
| Molecular Formula | C15H10N6S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 8-phenyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,14-pentaene-12-thione |
| SMILES | S=c1[nH]nc2n1nc1n(-c3ccccc3)c3ccccc3n12 |
| InChI | InChI=1S/C15H10N6S/c22-15-17-16-13-20-12-9-5-4-8-11(12)19(14(20)18-21(13)15)10-6-2-1-3-7-10/h1-9H,(H,17,22) |
| InChIKey | NLZVHRBMPHORSS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|