C13H15N3O3S2 — CID 2122705
3-(dimethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 2122705) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2122705 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)s1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-9-8-14-13(20-9)15-12(17)10-5-4-6-11(7-10)21(18,19)16(2)3/h4-8H,1-3H3,(H,14,15,17) |
| InChIKey | SYUJZRGIVGHXLO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |