C11H9F3N2O3S2 — CID 21227284
5-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]thiophene-2-sulfonamide (PubChem CID 21227284) has the molecular formula C11H9F3N2O3S2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 21227284 |
| Molecular Formula | C11H9F3N2O3S2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 5-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)s1 |
| InChI | InChI=1S/C11H9F3N2O3S2/c1-6-2-3-9(20-6)21(18,19)16-8-4-7(11(12,13)14)5-15-10(8)17/h2-5,16H,1H3,(H,15,17) |
| InChIKey | OELHUZFYLABVPM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |