About 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone
9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone (PubChem CID 21227364) has the molecular formula C25H23N3O
and a molecular weight of 381.48 g/mol. Its IUPAC name is 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone.
Molecular Properties
| Compound Name | 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone |
| PubChem CID | 21227364 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone |
| SMILES | CC(=O)c1cc2ccccc2nc1C.NC1c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C13H12N2.C12H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-8-11(9(2)14)7-10-5-3-4-6-12(10)13-8/h1-8,13,15H,14H2;3-7H,1-2H3 |
| InChIKey | OUBNOYJWIAIHSD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone?
The IUPAC name of 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone (CID 21227364) is 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone.
What is the SMILES notation for 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone?
The canonical SMILES for 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone is CC(=O)c1cc2ccccc2nc1C.NC1c2ccccc2Nc2ccccc21.
What is the InChIKey of 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone?
The InChIKey is OUBNOYJWIAIHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.C12H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-8-11(9(2)14)7-10-5-3-4-6-12(10)13-8/h1-8,13,15H,14H2;3-7H,1-2H3.
What are the key properties of 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone?
9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone has a molecular weight of 381.48 g/mol, XLogP of 5.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dihydroacridin-9-amine;1-(2-methylquinolin-3-yl)ethanone is sourced from PubChem (CID 21227364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).