About 2-ethylsulfanylpropane
2-ethylsulfanylpropane (PubChem CID 21228) has the molecular formula C5H12S
and a molecular weight of 104.22 g/mol. Its IUPAC name is 2-ethylsulfanylpropane.
Molecular Properties
| Compound Name | 2-ethylsulfanylpropane |
| PubChem CID | 21228 |
| Molecular Formula | C5H12S |
| Molecular Weight | 104.22 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | 2-ethylsulfanylpropane |
| SMILES | CCSC(C)C |
| InChI | InChI=1S/C5H12S/c1-4-6-5(2)3/h5H,4H2,1-3H3 |
| InChIKey | NZUQQADVSXWVNW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylpropane?
The IUPAC name of 2-ethylsulfanylpropane (CID 21228) is 2-ethylsulfanylpropane.
What is the SMILES notation for 2-ethylsulfanylpropane?
The canonical SMILES for 2-ethylsulfanylpropane is CCSC(C)C.
What is the InChIKey of 2-ethylsulfanylpropane?
The InChIKey is NZUQQADVSXWVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S/c1-4-6-5(2)3/h5H,4H2,1-3H3.
What are the key properties of 2-ethylsulfanylpropane?
2-ethylsulfanylpropane has a molecular weight of 104.22 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylpropane is sourced from PubChem (CID 21228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).