C28H24N2O7S — CID 21228476
4-[[4-[(Z)-[2-(4-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 21228476) has the molecular formula C28H24N2O7S and a molecular weight of 532.57 g/mol. Its IUPAC name is 4-[[4-[(Z)-[2-(4-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-[2-(4-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21228476 |
| Molecular Formula | C28H24N2O7S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 4-[[4-[(Z)-[2-(4-carboxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCN1C(=O)/C(=C/c2ccc(OCc3ccc(C(=O)O)cc3)c(OC)c2)S/C1=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H24N2O7S/c1-3-30-25(31)24(38-28(30)29-21-11-9-20(10-12-21)27(34)35)15-18-6-13-22(23(14-18)36-2)37-16-17-4-7-19(8-5-17)26(32)33/h4-15H,3,16H2,1-2H3,(H,32,33)(H,34,35)/b24-15-,29-28+ |
| InChIKey | VAEPPCJZZJHBIX-LERSRRNTSA-N |
| XLogP | 5.29 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|