About 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride
1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride (PubChem CID 21228537) has the molecular formula C17H28ClN3O4
and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
| PubChem CID | 21228537 |
| Molecular Formula | C17H28ClN3O4 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
| SMILES | CCCCOCC(O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1.Cl |
| InChI | InChI=1S/C17H27N3O4.ClH/c1-2-3-12-24-14-17(21)13-18-8-10-19(11-9-18)15-4-6-16(7-5-15)20(22)23;/h4-7,17,21H,2-3,8-14H2,1H3;1H |
| InChIKey | BWIJWPPQYIBUQE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The IUPAC name of 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride (CID 21228537) is 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
What is the SMILES notation for 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The canonical SMILES for 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride is CCCCOCC(O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1.Cl.
What is the InChIKey of 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The InChIKey is BWIJWPPQYIBUQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O4.ClH/c1-2-3-12-24-14-17(21)13-18-8-10-19(11-9-18)15-4-6-16(7-5-15)20(22)23;/h4-7,17,21H,2-3,8-14H2,1H3;1H.
What are the key properties of 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride has a molecular weight of 373.88 g/mol, XLogP of 2.32, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propan-2-ol;hydrochloride is sourced from PubChem (CID 21228537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).