C18H30Cl2N2O2-2 — CID 21228823
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-N',N'-di(propan-2-yl)ethane-1,2-diamine dichloride (PubChem CID 21228823) has the molecular formula C18H30Cl2N2O2-2 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-N',N'-di(propan-2-yl)ethane-1,2-diamine dichloride.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-N',N'-di(propan-2-yl)ethane-1,2-diamine dichloride |
|---|---|
| PubChem CID | 21228823 |
| Molecular Formula | C18H30Cl2N2O2-2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-N',N'-di(propan-2-yl)ethane-1,2-diamine dichloride |
| SMILES | CCN(CCN(C(C)C)C(C)C)c1ccc2c(c1)OCCO2.[Cl-].[Cl-] |
| InChI | InChI=1S/C18H30N2O2.2ClH/c1-6-19(9-10-20(14(2)3)15(4)5)16-7-8-17-18(13-16)22-12-11-21-17;;/h7-8,13-15H,6,9-12H2,1-5H3;2*1H/p-2 |
| InChIKey | PCVYWYGWIQOWDL-UHFFFAOYSA-L |
| XLogP | -2.59 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|