C22H19N4O4S+ — CID 21229365
(5E)-1-(4-methoxyphenyl)-5-[(3-methyl-5-oxo-2-phenyl-1,4-dihydropyrazol-2-ium-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 21229365) has the molecular formula C22H19N4O4S+ and a molecular weight of 435.49 g/mol. Its IUPAC name is (5E)-1-(4-methoxyphenyl)-5-[(3-methyl-5-oxo-2-phenyl-1,4-dihydropyrazol-2-ium-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(4-methoxyphenyl)-5-[(3-methyl-5-oxo-2-phenyl-1,4-dihydropyrazol-2-ium-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 21229365 |
| Molecular Formula | C22H19N4O4S+ |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (5E)-1-(4-methoxyphenyl)-5-[(3-methyl-5-oxo-2-phenyl-1,4-dihydropyrazol-2-ium-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(N2C(=O)/C(=C/C3C(=O)N[N+](c4ccccc4)=C3C)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C22H18N4O4S/c1-13-17(20(28)24-26(13)15-6-4-3-5-7-15)12-18-19(27)23-22(31)25(21(18)29)14-8-10-16(30-2)11-9-14/h3-12,17H,1-2H3,(H-,23,24,27,28,31)/p+1/b18-12+ |
| InChIKey | QLSDMOBTBRTXDM-LDADJPATSA-O |
| XLogP | 1.84 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|