About [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride
[3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride (PubChem CID 21230618) has the molecular formula C6H12Cl2N4O-2
and a molecular weight of 227.09 g/mol. Its IUPAC name is [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride.
Molecular Properties
| Compound Name | [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride |
| PubChem CID | 21230618 |
| Molecular Formula | C6H12Cl2N4O-2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride |
| SMILES | CNCCc1n[nH]c(CO)n1.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H12N4O.2ClH/c1-7-3-2-5-8-6(4-11)10-9-5;;/h7,11H,2-4H2,1H3,(H,8,9,10);2*1H/p-2 |
| InChIKey | ZNRCLFPEFLBYKP-UHFFFAOYSA-L |
| XLogP | -6.93 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | -6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride?
The IUPAC name of [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride (CID 21230618) is [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride.
What is the SMILES notation for [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride?
The canonical SMILES for [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride is CNCCc1n[nH]c(CO)n1.[Cl-].[Cl-].
What is the InChIKey of [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride?
The InChIKey is ZNRCLFPEFLBYKP-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12N4O.2ClH/c1-7-3-2-5-8-6(4-11)10-9-5;;/h7,11H,2-4H2,1H3,(H,8,9,10);2*1H/p-2.
What are the key properties of [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride?
[3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride has a molecular weight of 227.09 g/mol, XLogP of -6.93, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(methylamino)ethyl]-1H-1,2,4-triazol-5-yl]methanol dichloride is sourced from PubChem (CID 21230618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).