C15H19ClN4OS — CID 21231006
4-[[(E)-1-[5-(4-chloroanilino)-1,2,4-thiadiazol-3-yl]prop-1-en-2-yl]amino]butan-1-ol (PubChem CID 21231006) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 4-[[(E)-1-[5-(4-chloroanilino)-1,2,4-thiadiazol-3-yl]prop-1-en-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[(E)-1-[5-(4-chloroanilino)-1,2,4-thiadiazol-3-yl]prop-1-en-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 21231006 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[[(E)-1-[5-(4-chloroanilino)-1,2,4-thiadiazol-3-yl]prop-1-en-2-yl]amino]butan-1-ol |
| SMILES | C/C(=C\c1nsc(Nc2ccc(Cl)cc2)n1)NCCCCO |
| InChI | InChI=1S/C15H19ClN4OS/c1-11(17-8-2-3-9-21)10-14-19-15(22-20-14)18-13-6-4-12(16)5-7-13/h4-7,10,17,21H,2-3,8-9H2,1H3,(H,18,19,20)/b11-10+ |
| InChIKey | XXHHALBNQBNGDT-ZHACJKMWSA-N |
| XLogP | 3.66 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|