C21H16BrN3O3 — CID 21231606
5-[(4-bromophenyl)-(naphthalen-2-ylamino)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 21231606) has the molecular formula C21H16BrN3O3 and a molecular weight of 438.28 g/mol. Its IUPAC name is 5-[(4-bromophenyl)-(naphthalen-2-ylamino)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-bromophenyl)-(naphthalen-2-ylamino)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21231606 |
| Molecular Formula | C21H16BrN3O3 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 5-[(4-bromophenyl)-(naphthalen-2-ylamino)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(Nc2ccc3ccccc3c2)c2ccc(Br)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H16BrN3O3/c22-15-8-5-13(6-9-15)18(17-19(26)24-21(28)25-20(17)27)23-16-10-7-12-3-1-2-4-14(12)11-16/h1-11,17-18,23H,(H2,24,25,26,27,28) |
| InChIKey | XNBZLJQHRSXROM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|