About (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate
(3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate (PubChem CID 21231826) has the molecular formula C20H14ClN3O2
and a molecular weight of 363.80 g/mol. Its IUPAC name is (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate.
Molecular Properties
| Compound Name | (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate |
| PubChem CID | 21231826 |
| Molecular Formula | C20H14ClN3O2 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate |
| SMILES | Cc1cc(-c2ccccc2)n2nc(OC(=O)c3ccccc3)c(Cl)c2n1 |
| InChI | InChI=1S/C20H14ClN3O2/c1-13-12-16(14-8-4-2-5-9-14)24-18(22-13)17(21)19(23-24)26-20(25)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | TXZGPHGTQBBXRV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate?
The IUPAC name of (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate (CID 21231826) is (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate.
What is the SMILES notation for (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate?
The canonical SMILES for (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate is Cc1cc(-c2ccccc2)n2nc(OC(=O)c3ccccc3)c(Cl)c2n1.
What is the InChIKey of (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate?
The InChIKey is TXZGPHGTQBBXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClN3O2/c1-13-12-16(14-8-4-2-5-9-14)24-18(22-13)17(21)19(23-24)26-20(25)15-10-6-3-7-11-15/h2-12H,1H3.
What are the key properties of (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate?
(3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate has a molecular weight of 363.80 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-5-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-2-yl) benzoate is sourced from PubChem (CID 21231826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).