C18H23NO2 — CID 21231852
3-(2,3-dimethylphenyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 21231852) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(2,3-dimethylphenyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 21231852 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1cccc(N2C(=O)C3CCC(C)(C2=O)C3(C)C)c1C |
| InChI | InChI=1S/C18H23NO2/c1-11-7-6-8-14(12(11)2)19-15(20)13-9-10-18(5,16(19)21)17(13,3)4/h6-8,13H,9-10H2,1-5H3 |
| InChIKey | OSVKRYJQZURXKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|