C19H19N3O3S — CID 21233452
3-[(3-amino-6-butylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoic acid (PubChem CID 21233452) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 3-[(3-amino-6-butylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(3-amino-6-butylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 21233452 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-[(3-amino-6-butylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoic acid |
| SMILES | CCCCc1ccc2c(N)c(C(=O)Nc3cccc(C(=O)O)c3)sc2n1 |
| InChI | InChI=1S/C19H19N3O3S/c1-2-3-6-12-8-9-14-15(20)16(26-18(14)22-12)17(23)21-13-7-4-5-11(10-13)19(24)25/h4-5,7-10H,2-3,6,20H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | HQGFAVAATYBSFW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |