C18H22ClN2O4- — CID 21233673
2-[4-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-methoxyphenoxy]acetamide chloride (PubChem CID 21233673) has the molecular formula C18H22ClN2O4- and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-[4-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-methoxyphenoxy]acetamide chloride.
| Compound Name | 2-[4-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-methoxyphenoxy]acetamide chloride |
|---|---|
| PubChem CID | 21233673 |
| Molecular Formula | C18H22ClN2O4- |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-[4-[[(2-hydroxy-2-phenylethyl)amino]methyl]-2-methoxyphenoxy]acetamide chloride |
| SMILES | COc1cc(CNCC(O)c2ccccc2)ccc1OCC(N)=O.[Cl-] |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-23-17-9-13(7-8-16(17)24-12-18(19)22)10-20-11-15(21)14-5-3-2-4-6-14;/h2-9,15,20-21H,10-12H2,1H3,(H2,19,22);1H/p-1 |
| InChIKey | LPTUHIRHTFPEGP-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |