C10H13N3O3 — CID 21234974
5-(piperidin-1-ylmethylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 21234974) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(piperidin-1-ylmethylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21234974 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-(piperidin-1-ylmethylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=CN2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C10H13N3O3/c14-8-7(9(15)12-10(16)11-8)6-13-4-2-1-3-5-13/h6H,1-5H2,(H2,11,12,14,15,16) |
| InChIKey | GIDOAGZIHFPQFI-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|