C9H12F7NOS — CID 21235246
N,N-diethyl-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide (PubChem CID 21235246) has the molecular formula C9H12F7NOS and a molecular weight of 315.25 g/mol. Its IUPAC name is N,N-diethyl-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide.
| Compound Name | N,N-diethyl-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 21235246 |
| Molecular Formula | C9H12F7NOS |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N,N-diethyl-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide |
| SMILES | CCN(CC)C(=O)CSC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F7NOS/c1-3-17(4-2)6(18)5-19-9(15,16)7(10,11)8(12,13)14/h3-5H2,1-2H3 |
| InChIKey | HOZOBLREEAZOMN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|