C11H16F7NOS — CID 21235247
2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-N,N-dipropylacetamide (PubChem CID 21235247) has the molecular formula C11H16F7NOS and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-N,N-dipropylacetamide.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 21235247 |
| Molecular Formula | C11H16F7NOS |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CSC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F7NOS/c1-3-5-19(6-4-2)8(20)7-21-11(17,18)9(12,13)10(14,15)16/h3-7H2,1-2H3 |
| InChIKey | BLNSDRXEZQKTNG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|