About methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate
methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate (PubChem CID 2123527) has the molecular formula C19H20N2O4S2
and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate |
| PubChem CID | 2123527 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COc2cc3sc(C)nc3c3sccc23)CC1 |
| InChI | InChI=1S/C19H20N2O4S2/c1-11-20-17-15(27-11)9-14(13-5-8-26-18(13)17)25-10-16(22)21-6-3-12(4-7-21)19(23)24-2/h5,8-9,12H,3-4,6-7,10H2,1-2H3 |
| InChIKey | JLVNVNYMNYEWSG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate (CID 2123527) is methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate is COC(=O)C1CCN(C(=O)COc2cc3sc(C)nc3c3sccc23)CC1.
What is the InChIKey of methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate?
The InChIKey is JLVNVNYMNYEWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4S2/c1-11-20-17-15(27-11)9-14(13-5-8-26-18(13)17)25-10-16(22)21-6-3-12(4-7-21)19(23)24-2/h5,8-9,12H,3-4,6-7,10H2,1-2H3.
What are the key properties of methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate?
methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate has a molecular weight of 404.51 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxylate is sourced from PubChem (CID 2123527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).