C26H28N6O8 — CID 21235495
6-[4-[2-[4-(3,4-dimethyl-5-nitro-2-oxo-1,6-dihydropyrimidin-6-yl)phenoxy]ethoxy]phenyl]-3,4-dimethyl-5-nitro-1,6-dihydropyrimidin-2-one (PubChem CID 21235495) has the molecular formula C26H28N6O8 and a molecular weight of 552.54 g/mol. Its IUPAC name is 6-[4-[2-[4-(3,4-dimethyl-5-nitro-2-oxo-1,6-dihydropyrimidin-6-yl)phenoxy]ethoxy]phenyl]-3,4-dimethyl-5-nitro-1,6-dihydropyrimidin-2-one.
| Compound Name | 6-[4-[2-[4-(3,4-dimethyl-5-nitro-2-oxo-1,6-dihydropyrimidin-6-yl)phenoxy]ethoxy]phenyl]-3,4-dimethyl-5-nitro-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 21235495 |
| Molecular Formula | C26H28N6O8 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 6-[4-[2-[4-(3,4-dimethyl-5-nitro-2-oxo-1,6-dihydropyrimidin-6-yl)phenoxy]ethoxy]phenyl]-3,4-dimethyl-5-nitro-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C([N+](=O)[O-])C(c2ccc(OCCOc3ccc(C4NC(=O)N(C)C(C)=C4[N+](=O)[O-])cc3)cc2)NC(=O)N1C |
| InChI | InChI=1S/C26H28N6O8/c1-15-23(31(35)36)21(27-25(33)29(15)3)17-5-9-19(10-6-17)39-13-14-40-20-11-7-18(8-12-20)22-24(32(37)38)16(2)30(4)26(34)28-22/h5-12,21-22H,13-14H2,1-4H3,(H,27,33)(H,28,34) |
| InChIKey | YUQPJMSEFPZIHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|