C24H23Cl3N2O4S2 — CID 21236146
(NE)-2,4,6-trimethyl-N-[(4Z)-2,3,5-trichloro-4-(2,4,6-trimethylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide (PubChem CID 21236146) has the molecular formula C24H23Cl3N2O4S2 and a molecular weight of 573.95 g/mol. Its IUPAC name is (NE)-2,4,6-trimethyl-N-[(4Z)-2,3,5-trichloro-4-(2,4,6-trimethylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide.
| Compound Name | (NE)-2,4,6-trimethyl-N-[(4Z)-2,3,5-trichloro-4-(2,4,6-trimethylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 21236146 |
| Molecular Formula | C24H23Cl3N2O4S2 |
| Molecular Weight | 573.95 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | (NE)-2,4,6-trimethyl-N-[(4Z)-2,3,5-trichloro-4-(2,4,6-trimethylphenyl)sulfonyliminocyclohexa-2,5-dien-1-ylidene]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)/N=C2/C(Cl)=C/C(=N\S(=O)(=O)c3c(C)cc(C)cc3C)C(Cl)=C2Cl)c(C)c1 |
| InChI | InChI=1S/C24H23Cl3N2O4S2/c1-12-7-14(3)23(15(4)8-12)34(30,31)28-19-11-18(25)22(21(27)20(19)26)29-35(32,33)24-16(5)9-13(2)10-17(24)6/h7-11H,1-6H3/b28-19+,29-22- |
| InChIKey | ILOBAHXPWVOIRF-GWSMQPDNSA-N |
| XLogP | 6.32 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.95 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|