C21H21N3O4 — CID 21236243
2-[(benzylamino)methylidene]-N,N'-bis(furan-2-ylmethyl)propanediamide (PubChem CID 21236243) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(benzylamino)methylidene]-N,N'-bis(furan-2-ylmethyl)propanediamide.
| Compound Name | 2-[(benzylamino)methylidene]-N,N'-bis(furan-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 21236243 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(benzylamino)methylidene]-N,N'-bis(furan-2-ylmethyl)propanediamide |
| SMILES | O=C(NCc1ccco1)C(=CNCc1ccccc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H21N3O4/c25-20(23-13-17-8-4-10-27-17)19(15-22-12-16-6-2-1-3-7-16)21(26)24-14-18-9-5-11-28-18/h1-11,15,22H,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | CPDOTRYCCGHETL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|