About N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine
N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine (PubChem CID 21236535) has the molecular formula C25H27N3
and a molecular weight of 369.51 g/mol. Its IUPAC name is N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine |
| PubChem CID | 21236535 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine |
| SMILES | Cc1ccc(/N=C(/C(c2ccccc2)c2ccccc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C25H27N3/c1-20-12-14-23(15-13-20)27-25(28-18-16-26-17-19-28)24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,24,26H,16-19H2,1H3/b27-25- |
| InChIKey | RCJLOSASASEQBG-RFBIWTDZSA-N |
| XLogP | 4.76 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine?
The IUPAC name of N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine (CID 21236535) is N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine.
What is the SMILES notation for N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine?
The canonical SMILES for N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine is Cc1ccc(/N=C(/C(c2ccccc2)c2ccccc2)N2CCNCC2)cc1.
What is the InChIKey of N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine?
The InChIKey is RCJLOSASASEQBG-RFBIWTDZSA-N. The full InChI is InChI=1S/C25H27N3/c1-20-12-14-23(15-13-20)27-25(28-18-16-26-17-19-28)24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,24,26H,16-19H2,1H3/b27-25-.
What are the key properties of N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine?
N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine has a molecular weight of 369.51 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-2,2-diphenyl-1-piperazin-1-ylethanimine is sourced from PubChem (CID 21236535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).