C26H24N2O5 — CID 21237091
propan-2-yl 4-(2-benzoyloxynaphthalen-1-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 21237091) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is propan-2-yl 4-(2-benzoyloxynaphthalen-1-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(2-benzoyloxynaphthalen-1-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 21237091 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | propan-2-yl 4-(2-benzoyloxynaphthalen-1-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2c(OC(=O)c3ccccc3)ccc3ccccc23)NC(=O)N1 |
| InChI | InChI=1S/C26H24N2O5/c1-15(2)32-25(30)21-16(3)27-26(31)28-23(21)22-19-12-8-7-9-17(19)13-14-20(22)33-24(29)18-10-5-4-6-11-18/h4-15,23H,1-3H3,(H2,27,28,31) |
| InChIKey | PWYFPZKXXUTNDI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|