C26H21N3O4 — CID 21237255
4-(3-nitrophenyl)-1,3-diphenyl-4,6,7,8-tetrahydroquinazoline-2,5-dione (PubChem CID 21237255) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-1,3-diphenyl-4,6,7,8-tetrahydroquinazoline-2,5-dione.
| Compound Name | 4-(3-nitrophenyl)-1,3-diphenyl-4,6,7,8-tetrahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 21237255 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-(3-nitrophenyl)-1,3-diphenyl-4,6,7,8-tetrahydroquinazoline-2,5-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc([N+](=O)[O-])c1)N(c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C26H21N3O4/c30-23-16-8-15-22-24(23)25(18-9-7-14-21(17-18)29(32)33)28(20-12-5-2-6-13-20)26(31)27(22)19-10-3-1-4-11-19/h1-7,9-14,17,25H,8,15-16H2 |
| InChIKey | MVDJAERAJOXHFY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|