C23H33ClNO3- — CID 21237452
1-[4-(1-adamantyl)phenoxy]-3-morpholin-4-ylpropan-2-ol chloride (PubChem CID 21237452) has the molecular formula C23H33ClNO3- and a molecular weight of 406.97 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)phenoxy]-3-morpholin-4-ylpropan-2-ol chloride.
| Compound Name | 1-[4-(1-adamantyl)phenoxy]-3-morpholin-4-ylpropan-2-ol chloride |
|---|---|
| PubChem CID | 21237452 |
| Molecular Formula | C23H33ClNO3- |
| Molecular Weight | 406.97 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-[4-(1-adamantyl)phenoxy]-3-morpholin-4-ylpropan-2-ol chloride |
| SMILES | OC(COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)CN1CCOCC1.[Cl-] |
| InChI | InChI=1S/C23H33NO3.ClH/c25-21(15-24-5-7-26-8-6-24)16-27-22-3-1-20(2-4-22)23-12-17-9-18(13-23)11-19(10-17)14-23;/h1-4,17-19,21,25H,5-16H2;1H/p-1 |
| InChIKey | DMQQNXNOHGAIQG-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.97 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |