C17H27ClNO3- — CID 21237651
1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethylphenoxy)propan-2-ol chloride (PubChem CID 21237651) has the molecular formula C17H27ClNO3- and a molecular weight of 328.86 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethylphenoxy)propan-2-ol chloride.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethylphenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 21237651 |
| Molecular Formula | C17H27ClNO3- |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-3-(4-ethylphenoxy)propan-2-ol chloride |
| SMILES | CCc1ccc(OCC(O)CN2CC(C)OC(C)C2)cc1.[Cl-] |
| InChI | InChI=1S/C17H27NO3.ClH/c1-4-15-5-7-17(8-6-15)20-12-16(19)11-18-9-13(2)21-14(3)10-18;/h5-8,13-14,16,19H,4,9-12H2,1-3H3;1H/p-1 |
| InChIKey | BTQRDDXGGRJRCJ-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |