About diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium
diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium (PubChem CID 21237917) has the molecular formula C36H34N4P2S2
and a molecular weight of 648.78 g/mol. Its IUPAC name is diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium.
Molecular Properties
| Compound Name | diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium |
| PubChem CID | 21237917 |
| Molecular Formula | C36H34N4P2S2 |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium |
| SMILES | S=P([S-])(c1ccccc1)c1ccccc1.c1ccc(N[P+](Nc2ccccc2)(Nc2ccccc2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4P.C12H11PS2/c1-5-13-21(14-6-1)25-29(26-22-15-7-2-8-16-22,27-23-17-9-3-10-18-23)28-24-19-11-4-12-20-24;14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-20,25-28H;1-10H,(H,14,15)/q+1;/p-1 |
| InChIKey | HLECQPBRRSQOQK-UHFFFAOYSA-M |
| XLogP | 9.69 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium?
The IUPAC name of diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium (CID 21237917) is diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium.
What is the SMILES notation for diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium?
The canonical SMILES for diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium is S=P([S-])(c1ccccc1)c1ccccc1.c1ccc(N[P+](Nc2ccccc2)(Nc2ccccc2)Nc2ccccc2)cc1.
What is the InChIKey of diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium?
The InChIKey is HLECQPBRRSQOQK-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H24N4P.C12H11PS2/c1-5-13-21(14-6-1)25-29(26-22-15-7-2-8-16-22,27-23-17-9-3-10-18-23)28-24-19-11-4-12-20-24;14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-20,25-28H;1-10H,(H,14,15)/q+1;/p-1.
What are the key properties of diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium?
diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium has a molecular weight of 648.78 g/mol, XLogP of 9.69, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-sulfanylidene-sulfido-λ5-phosphane;tetraanilinophosphanium is sourced from PubChem (CID 21237917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).