About 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol
4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol (PubChem CID 21238087) has the molecular formula C16H9Cl3N2O
and a molecular weight of 351.62 g/mol. Its IUPAC name is 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol |
| PubChem CID | 21238087 |
| Molecular Formula | C16H9Cl3N2O |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1cc(/N=N/c2c(Cl)cc(Cl)cc2Cl)c2ccccc2c1 |
| InChI | InChI=1S/C16H9Cl3N2O/c17-10-6-13(18)16(14(19)7-10)21-20-15-8-11(22)5-9-3-1-2-4-12(9)15/h1-8,22H/b21-20+ |
| InChIKey | XWUVPIVDGAZCNB-QZQOTICOSA-N |
| XLogP | 6.92 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol?
The IUPAC name of 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol (CID 21238087) is 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol.
What is the SMILES notation for 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol?
The canonical SMILES for 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol is Oc1cc(/N=N/c2c(Cl)cc(Cl)cc2Cl)c2ccccc2c1.
What is the InChIKey of 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol?
The InChIKey is XWUVPIVDGAZCNB-QZQOTICOSA-N. The full InChI is InChI=1S/C16H9Cl3N2O/c17-10-6-13(18)16(14(19)7-10)21-20-15-8-11(22)5-9-3-1-2-4-12(9)15/h1-8,22H/b21-20+.
What are the key properties of 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol?
4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol has a molecular weight of 351.62 g/mol, XLogP of 6.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4,6-trichlorophenyl)diazenyl]naphthalen-2-ol is sourced from PubChem (CID 21238087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).