C14H18N2O6 — CID 21238380
ethyl 2-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]acetate (PubChem CID 21238380) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is ethyl 2-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]acetate.
| Compound Name | ethyl 2-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]acetate |
|---|---|
| PubChem CID | 21238380 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | ethyl 2-[[4-[(2-ethoxy-2-oxoethyl)amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]acetate |
| SMILES | CCOC(=O)CNC1=CC(=O)C(NCC(=O)OCC)=CC1=O |
| InChI | InChI=1S/C14H18N2O6/c1-3-21-13(19)7-15-9-5-12(18)10(6-11(9)17)16-8-14(20)22-4-2/h5-6,15-16H,3-4,7-8H2,1-2H3 |
| InChIKey | HELPWYIMXSIOSF-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|