About 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride
2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride (PubChem CID 21238819) has the molecular formula C13H17Cl2N2O2S-
and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride |
| PubChem CID | 21238819 |
| Molecular Formula | C13H17Cl2N2O2S- |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride |
| SMILES | O/N=C(/SCCN1CCOCC1)c1cccc(Cl)c1.[Cl-] |
| InChI | InChI=1S/C13H17ClN2O2S.ClH/c14-12-3-1-2-11(10-12)13(15-17)19-9-6-16-4-7-18-8-5-16;/h1-3,10,17H,4-9H2;1H/p-1/b15-13+; |
| InChIKey | GBHJRIAFAJGVAJ-GVYCEHEKSA-M |
| XLogP | -0.45 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride?
The IUPAC name of 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride (CID 21238819) is 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride.
What is the SMILES notation for 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride?
The canonical SMILES for 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride is O/N=C(/SCCN1CCOCC1)c1cccc(Cl)c1.[Cl-].
What is the InChIKey of 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride?
The InChIKey is GBHJRIAFAJGVAJ-GVYCEHEKSA-M. The full InChI is InChI=1S/C13H17ClN2O2S.ClH/c14-12-3-1-2-11(10-12)13(15-17)19-9-6-16-4-7-18-8-5-16;/h1-3,10,17H,4-9H2;1H/p-1/b15-13+;.
What are the key properties of 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride?
2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride has a molecular weight of 336.26 g/mol, XLogP of -0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl (1E)-3-chloro-N-hydroxybenzenecarboximidothioate chloride is sourced from PubChem (CID 21238819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).