C11H10F7N3O2S — CID 21238960
2-[2,6-diamino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid (PubChem CID 21238960) has the molecular formula C11H10F7N3O2S and a molecular weight of 381.27 g/mol. Its IUPAC name is 2-[2,6-diamino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid.
| Compound Name | 2-[2,6-diamino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid |
|---|---|
| PubChem CID | 21238960 |
| Molecular Formula | C11H10F7N3O2S |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-[2,6-diamino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid |
| SMILES | Nc1cc(SC(F)(F)C(F)(F)C(F)(F)F)cc(N)c1NCC(=O)O |
| InChI | InChI=1S/C11H10F7N3O2S/c12-9(13,10(14,15)16)11(17,18)24-4-1-5(19)8(6(20)2-4)21-3-7(22)23/h1-2,21H,3,19-20H2,(H,22,23) |
| InChIKey | KFONWXGPBLUPEJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|